Table of Contents
What is the molecular formula for As2O5?
As2O5
Arsenic pentoxide/Formula
Which is the oxidation state of arsenic in As2O5?
Arsenic pentoxide is the inorganic compound with the formula As2O5. This glassy, white, deliquescent solid is relatively unstable, consistent with the rarity of the As(V) oxidation state. More common, and far more important commercially, is arsenic(III) oxide (As2O3).
What is the correct name for P2O5?
tricyclo[3.3.1.13,7]tetraphosphoxane 1,3,5,7-tetraoxide
Phosphorus pentoxide/IUPAC ID
What is the name of the covalent compound n2o5?
Dinitrogen pentoxide
Nitrogen pentoxide
PubChem CID | 66242 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | N2O5 |
Synonyms | Dinitrogen pentoxide Dinitrogen pentaoxide Nitrogen pentoxide 10102-03-1 nitro nitrate More… |
Molecular Weight | 108.01 |
What is the molar mass of As2O5?
229.8402 g/mol
Arsenic pentoxide/Molar mass
Is As2O5 basic?
As2O5 is dissolved in water to form arsenic acid, H3AsO4 – then As2O5 is more acidic,then As2O3 is more basic.
What is the oxidation number of As2O5?
As2O5: O is usually -2 (rule 7) so a total negative charge of -10; therefore 2 As = +10 and each As is +5.
What is the formula for P2O5?
P₂O₅
Phosphorus pentoxide/Formula
What is the name for the compound with the formula RbF?
Rubidium fluoride
Rubidium fluoride
PubChem CID | 83473 |
---|---|
Molecular Formula | FRb |
Synonyms | Rubidium fluoride 13446-74-7 Rubidium fluoride (RbF) EINECS 236-603-2 rubidium(1+);fluoride More… |
Molecular Weight | 104.466 |
Component Compounds | CID 14917 (Hydrofluoric acid) CID 5357696 (Rubidium) |
What is the name of the compound with the formula pcl5?
Phosphorus pentachloride
Phosphorus(V) chloride
Phosphorus pentachloride/IUPAC ID
What are the empirical formula and empirical formula mass for As2O5?
Identification of ARSENIC PENTOXIDE Chemical Compound
Chemical Formula | As2O5 |
---|---|
Molecular Weight | 229.8402 g/mol |
IUPAC Name | diarsooxidane |
SMILES String | O=[As](=O)O[As](=O)=O |
InChI | InChI=1S/As2O5/c3-1(4)7-2(5)6 |
What is the name of the compound with the formula N2O5?
The name for N2O5 is dinitrogen pentoxide. The two atoms of nitrogen require the prefix di- to be used and the five oxygen atoms in the formula are represented by pentoxide. What is the name for the compound with the formula SF6?
Which is the closest compound to as4o10?
The name of As4O10 would be tetraarsenic decoxide. It is not a real compound. The closest real compound is As2O5, which is arsenic pentoxide. Is as2o5 covalent?
Which is the correct formula for As2O5 pentoxide?
Alias: Diarsenic Pentaoxide Formula: As2O5 Molar Mass: 229.8402 Example Reactions: • 3BaO + As2O5 = Ba3(AsO4)2 • As2O5 + 3H2O = 2H3AsO4 • As2O5 + 3Ca(OH)2 = Ca3(AsO4)2 + 3H2O • As2O3 + 2H2O + 2I2 = As2O5 + 4HI
Which is the correct formula for arsenic ( V ) pentoxide?
Arsenic(V) Pentoxide Name: Arsenic(V) Pentoxide Alias: Diarsenic Pentaoxide Formula: As2O5 Molar Mass: 229.8402 Example Reactions: • 3BaO + As2O5 = Ba3(AsO4)2 • As2O5 + 3H2O = 2H3AsO4